| • Science | • People | • Locations | • Timeline |
| d-Lysergic acid | |
|---|---|
| Chemical name | 6-Methyl-9,10-didehydro-ergoline-8-carboxylic acid or 7-methyl-4,6,6a,7,8,9-hexahydro-indolo[4,3-fg] quinoline-9-carboxylic acid |
| Chemical formula | C16H16N2O2 |
| Molecular mass | 268.31 g/mol |
| Melting point | 238 - 240 °C |
| CAS numbers | 82-58-6, 478-95-5, 6915-32-8, 23953-76-6, 68985-97-7, 68985-98-8 |
| SMILES | O=[C@](O)[C@H]1CN(C)[C@](C2=C1) ([H])CC3=CNC4=C3C2=CC=C4 |
Lysergic acid, d-lysergic acid, or (+)-lysergic acid is a precursor for a wide range of ergoline alkaloids that are produced by the ergot fungus and some plants. Amides of lysergic acid, commonly called lysergamides, are widely used as pharmaceuticals and as hallucinogenic drugs ( LSD). Lysergic acid is usually produced by hydrolysis of lysergamides, but can also be synthesized in the laboratory by a complex total syntheses. Lysergic acid is a chiral compound with two stereocenterA stereocenter is an atom in a chemical compound that has four different atoms or groups of atoms attached to it.s. The isomerIn chemistry, isomers are molecules with the same chemical formula and often with the same kinds of bonds between atoms, but in which the atoms are arranged differently. Many isomers share similar if not identical properties in most chemical contexts. with inverted configuration at carbon atom 8 close to the carboxyA carboxyl or carboxylic group is a functional group consisting of a carbon atom and an oxygen atom doubly bonded to each other. It is the univalent acid radical COOH : where R is a hydrogen or an organic group. Carboxyl groups are characteristic constitu group is called isolysergic acid. Inversion at carbon 5 close to the nitrogenNitrogen is the chemical element in the periodic table that has the symbol N and atomic number 7. A common normally colorless, odorless, tasteless and mostly inert diatomic non-metal gas, nitrogen constitutes 78 percent of Earth's atmosphere and is a cons atom leads to l-lysergic acid and l-isolysergic acid, respectively.